Introduction：Basic information about CAS 4077-76-3|Dimethyl 1H-pyrazole-3,5-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethyl 1H-pyrazole-3,5-dicarboxylate |
|---|
| CAS Number | 4077-76-3 | Molecular Weight | 184.149 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 343.8±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H8N2O4 | Melting Point | 151-152°C |
|---|
| MSDS | / | Flash Point | 161.7±22.3 °C |
|---|
Names
| Name | Dimethyl 1H-pyrazole-3,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 343.8±22.0 °C at 760 mmHg |
|---|
| Melting Point | 151-152°C |
|---|
| Molecular Formula | C7H8N2O4 |
|---|
| Molecular Weight | 184.149 |
|---|
| Flash Point | 161.7±22.3 °C |
|---|
| Exact Mass | 184.048401 |
|---|
| PSA | 81.28000 |
|---|
| LogP | 0.15 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.531 |
|---|
| InChIKey | SIPQVJNEQSWAOK-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(C(=O)OC)[nH]n1 |
|---|
Safety Information
Synonyms
| dimethyl pyrazole-3,5-dicarboxylate |
| Pyrazol-3,5-dicarbonsaeure-dimethylester |
| Dimethyl 1H-pyrazole-3,5-dicarboxylate |
| pyrazole-3,5-dicarboxylic acid dimethyl ester |
| dimethylpyrazoledicarboxylate |
| 1H-pyrazole-3,5-dicarboxylic acid dimethyl ester |
| 1H-Pyrazole-3,5-dicarboxylic acid, dimethyl ester |
| 3,5-dimethyl 1H-pyrazole-3,5-dicarboxylate |
