Introduction:Basic information about CAS 1286170-85-1|1,8-Dibromo-4,5-dimethoxypyrene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,8-Dibromo-4,5-dimethoxypyrene |
|---|
| CAS Number | 1286170-85-1 | Molecular Weight | 420.09500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H12Br2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,8-Dibromo-4,5-dimethoxypyrene |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H12Br2O2 |
|---|
| Molecular Weight | 420.09500 |
|---|
| Exact Mass | 417.92000 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 6.12620 |
|---|
| InChIKey | JMVGDSOPCGIBLM-UHFFFAOYSA-N |
|---|
| SMILES | COc1c(OC)c2ccc(Br)c3ccc4c(Br)ccc1c4c32 |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|