Introduction：Basic information about CAS 19125-99-6|solvent yellow 43, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | solvent yellow 43 |
|---|
| CAS Number | 19125-99-6 | Molecular Weight | 324.417 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 500.4±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6FN3O5 | Melting Point | 126-127ºC |
|---|
| MSDS | / | Flash Point | 256.4±25.4 °C |
|---|
Names
| Name | solvent yellow 43 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 500.4±33.0 °C at 760 mmHg |
|---|
| Melting Point | 126-127ºC |
|---|
| Molecular Formula | C8H6FN3O5 |
|---|
| Molecular Weight | 324.417 |
|---|
| Flash Point | 256.4±25.4 °C |
|---|
| Exact Mass | 324.183777 |
|---|
| PSA | 120.74000 |
|---|
| LogP | 3.75 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | DXWHZJXKTHGHQF-UHFFFAOYSA-N |
|---|
| SMILES | CCCCNc1ccc2c3c(cccc13)C(=O)N(CCCC)C2=O |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-n-butylaminonaphthalic-1,8-N-n-butylimide |
| 4-n-butylamino-5-amino-6-chloropyrimidine |
| N4-Butyl-6-chlor-pyrimidin-4,5-diyldiamin |
| 4-n-butylamino-9-n-butyl-1,8-naphthalimide |
| 2-Butyl-6-(butylamino)-1H-benzo[de]isoquinoline-1,3(2H)-dione |
| N-butyl-4-n-butylamino-1,8-naphthalimide |
| 2-Butyl-6-(butylamino)-1H-benz(de)isoquinoline-1,3(2H)-dione |
| 4-n-butylamino-N-n-butyl-1,8-naphthalic imide |
| N4-butyl-6-chloro-pyrimidine-4,5-diyldiamine |
| 4-n-butylamino-N-butylnaphthalic-1,8-imide |
| 1H-Benz[de]isoquinoline-1,3(2H)-dione, 2-butyl-6-(butylamino)- |
| n4-butyl-6-chloropyrimidine-4,5-diamine |
| 1H-BENZ(DE)ISOQUINOLINE-1,3(2H)-DIONE, 2-BUTYL-6-(BUTYLAMINO)- |
