Introduction:Basic information about CAS 129188-99-4|1,1-bis(4-hydroxyphenyl)-3,3,5-trimethylcyclohexane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1-bis(4-hydroxyphenyl)-3,3,5-trimethylcyclohexane |
|---|
| CAS Number | 129188-99-4 | Molecular Weight | 310.430 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 450.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H26O2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 202.8±21.4 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-[1-(4-hydroxyphenyl)-3,3,5-trimethylcyclohexyl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 450.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H26O2 |
|---|
| Molecular Weight | 310.430 |
|---|
| Flash Point | 202.8±21.4 °C |
|---|
| Exact Mass | 310.193268 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 6.06 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | UMPGNGRIGSEMTC-UHFFFAOYSA-N |
|---|
| SMILES | CC1CC(C)(C)CC(c2ccc(O)cc2)(c2ccc(O)cc2)C1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| L6TJ A1 A1 CR DQ& CR DQ& E1 |
| BISP-TMC |
| 4,4'-(3,3,5-Trimethylcyclohexane-1,1-diyl)diphenol |
| Phenol, 4,4'-(3,3,5-trimethylcyclohexylidene)bis- |
| 4,4'-(3,3,5-Trimethyl-1,1-cyclohexanediyl)diphenol |
| Bisphenol TMC |
| BPTMC |
| 4,4'-(3,3,5-Trimethylcyclohexylidene)bisphenol |