Introduction:Basic information about CAS 157794-54-2|tris(2-(isopropylamino)ethyl)amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tris(2-(isopropylamino)ethyl)amine |
|---|
| CAS Number | 157794-54-2 | Molecular Weight | 272.47300 |
|---|
| Density | 0.858 g/mL at 25ºC(lit.) | Boiling Point | 120ºC/0.5 mmHg(lit.) |
|---|
| Molecular Formula | C15H36N4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 62ºC |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | N-propan-2-yl-N',N'-bis[2-(propan-2-ylamino)ethyl]ethane-1,2-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.858 g/mL at 25ºC(lit.) |
|---|
| Boiling Point | 120ºC/0.5 mmHg(lit.) |
|---|
| Molecular Formula | C15H36N4 |
|---|
| Molecular Weight | 272.47300 |
|---|
| Flash Point | 62ºC |
|---|
| Exact Mass | 272.29400 |
|---|
| PSA | 39.33000 |
|---|
| LogP | 2.45510 |
|---|
| Vapour Pressure | 0.000951mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.453 |
|---|
| InChIKey | XUIXOJXQJNMJGQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)NCCN(CCNC(C)C)CCNC(C)C |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | UN 2735 8/PG 2 |
|---|
| HS Code | 2921290000 |
|---|
Customs
| HS Code | 2921290000 |
|---|
| Summary | 2921290000 other acyclic polyamines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Tris[2-(isopropylamino)ethyl]amine |
| tris[2-(diisopropylamino)ethyl]amine |
| 1,2-Ethanediamine,N'-(1-methylethyl)-N,N-bis[2-[(1-methylethyl)amino]ethyl]-(9CI) |
| 1,2-Ethanediamine,N2-(1-methylethyl)-N1,N1-bis[2-[(1-methylethyl)amino]ethyl] |
| tris(i-propylaminoethyl)amine |
| MFCD06411346 |