Introduction:Basic information about CAS 115549-04-7|2,3,4-Trichloro-5-fluorobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4-Trichloro-5-fluorobenzoic acid |
|---|
| CAS Number | 115549-04-7 | Molecular Weight | 243.447 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 335.9±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H2Cl3FO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.9±26.5 °C |
|---|
Names
| Name | 2,3,4-Trichloro-5-fluorobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 335.9±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H2Cl3FO2 |
|---|
| Molecular Weight | 243.447 |
|---|
| Flash Point | 156.9±26.5 °C |
|---|
| Exact Mass | 241.910446 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.45 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | XADYKNXAUYNLFG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(F)c(Cl)c(Cl)c1Cl |
|---|
Synonyms
| Benzoic acid,2,3,4-trichloro-5-fluoro |
| 2,3,4-Trichloro-5-fluorobenzoic acid |
| Benzoic acid, 2,3,4-trichloro-5-fluoro- |
| 5-Fluoro-2,3,4-trichlorobenzoic acid |