Introduction：Basic information about CAS 853910-00-6|(2-Fluoro-4-nitrophenyl)acetonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-Fluoro-4-nitrophenyl)acetonitrile |
|---|
| CAS Number | 853910-00-6 | Molecular Weight | 180.136 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 335.5±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5FN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.7±23.7 °C |
|---|
Names
| Name | (2-Fluoro-4-nitrophenyl)acetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 335.5±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5FN2O2 |
|---|
| Molecular Weight | 180.136 |
|---|
| Flash Point | 156.7±23.7 °C |
|---|
| Exact Mass | 180.033508 |
|---|
| PSA | 69.61000 |
|---|
| LogP | 1.13 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | YTILGOKQDCCMQS-UHFFFAOYSA-N |
|---|
| SMILES | N#CCc1ccc([N+](=O)[O-])cc1F |
|---|
Synonyms
| Benzeneacetonitrile, 2-fluoro-4-nitro- |
| 4-(Carboxymethyl)-3-fluorotoluene |
| (2-Fluoro-4-nitrophenyl)acetonitrile |
| (2-fluoro-4-methylphenyl)acetic acid |
| (2-fluoro-4-nitro-phenyl)-acetonitrile |
