Introduction：Basic information about CAS 90104-48-6|N-{(2R)-1-[(2-Amino-2-oxoethyl)amino]-1-oxo-2-phenyl-2-butanyl}-L -prolinamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-{(2R)-1-[(2-Amino-2-oxoethyl)amino]-1-oxo-2-phenyl-2-butanyl}-L -prolinamide |
|---|
| CAS Number | 90104-48-6 | Molecular Weight | 332.39700 |
|---|
| Density | 1.205g/cm3 | Boiling Point | 704.6ºC at 760mmHg |
|---|
| Molecular Formula | C17H24N4O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 379.9ºC |
|---|
Names
| Name | N-{(2R)-1-[(2-Amino-2-oxoethyl)amino]-1-oxo-2-phenyl-2-butanyl}-L -prolinamide |
|---|
Chemical & Physical Properties
| Density | 1.205g/cm3 |
|---|
| Boiling Point | 704.6ºC at 760mmHg |
|---|
| Molecular Formula | C17H24N4O3 |
|---|
| Molecular Weight | 332.39700 |
|---|
| Flash Point | 379.9ºC |
|---|
| Exact Mass | 332.18500 |
|---|
| PSA | 121.29000 |
|---|
| LogP | 2.92070 |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | ZALQKBPFOWAOHH-SUMWQHHRSA-N |
|---|
| SMILES | CCC(NC(=O)C1CCCN1)(C(=O)NCC(N)=O)c1ccccc1 |
|---|
