Introduction：Basic information about CAS 70788-27-1|AcefyllineClofibrol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | AcefyllineClofibrol |
|---|
| CAS Number | 70788-27-1 | Molecular Weight | 420.84700 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 605.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H21ClN4O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 319.9ºC |
|---|
Names
| Name | [2-(4-chlorophenoxy)-2-methylpropyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 605.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H21ClN4O5 |
|---|
| Molecular Weight | 420.84700 |
|---|
| Flash Point | 319.9ºC |
|---|
| Exact Mass | 420.12000 |
|---|
| PSA | 97.35000 |
|---|
| LogP | 1.48790 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | ICVMNUSJJHSLLM-UHFFFAOYSA-N |
|---|
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)OCC(C)(C)Oc2ccc(Cl)cc2)n(C)c1=O |
|---|
Synonyms
| Acefylline clofibrol |
| Acetylline clofibrol |
| Acefylline clofibrol [INN] |
| Theophylline-7-acetate de 2-(p-chlorophenoxy)-2-methylpropyle [French] |
| Acefyllinum clofibrolum [INN-Latin] |
| 7H-Purine-7-acetic acid,1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-,2-(4-chlorophenoxy)-2-methylpropyl ester |
| 2-(4-Chlorphenoxy)-2-methylpropyl 1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7-purinylacetat |
| Acefilina clofibrol [INN-Spanish] |
| Acefilina clofibrol |
