Introduction：Basic information about CAS 113400-36-5|Boc-L-Pyroglutamic acid benzyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-L-Pyroglutamic acid benzyl ester |
|---|
| CAS Number | 113400-36-5 | Molecular Weight | 319.352 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 464.9±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H21NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.0±26.8 °C |
|---|
Names
| Name | 2-O-benzyl 1-O-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 464.9±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H21NO5 |
|---|
| Molecular Weight | 319.352 |
|---|
| Flash Point | 235.0±26.8 °C |
|---|
| Exact Mass | 319.141968 |
|---|
| PSA | 72.91000 |
|---|
| LogP | 1.37 |
|---|
| Appearance of Characters | Powder | White |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | TZNBTMCEMLXYEM-ZDUSSCGKSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCC1C(=O)OCc1ccccc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933790090 |
|---|
Customs
| HS Code | 2933790090 |
|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
|---|
Synonyms
| 1,2-Pyrrolidinedicarboxylic acid,5-oxo-,1-(1,1-dimethylethyl)2-(phenylmethyl) ester,(S) |
| benzyl 1-(t-butoxycarbonyl)pyroglutamate |
| (S)-2-Benzyl 1-tert-butyl 5-oxopyrrolidine-1,2-dicarboxylate |
| 2-Benzyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate |
| phenylmethyl (S)-1-(1,1-dimethylethoxycarbonyl)-5-oxopyrrolidine-2-carboxylate |
| Boc-L-Pyroglutamicacidbenzylester |
| 2-benzyl 1-tert-butyl (2S)-5-oxo-1,2-pyrrolidinedicarboxylate |
| 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) 2-(phenylmethyl) ester, (2S)- |
| 2-Benzyl 1-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
| PYR294 |
| (2S)-benzyl N-(tert-butyloxycarbonyl)-pyroglutamate |
| benzyl (2S)-N-tert-butoxycarbonyl-pyroglutamate |
| Boc-L-Pyroglutamic acid benzyl ester |
| Boc-Pyr-OBzl |
