Introduction:Basic information about CAS 123412-45-3|N-(2-Chloropyridine-4-carbonyl)-L-proline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(2-Chloropyridine-4-carbonyl)-L-proline |
|---|
| CAS Number | 123412-45-3 | Molecular Weight | 254.67000 |
|---|
| Density | 1.461g/cm3 | Boiling Point | 505ºC at 760mmHg |
|---|
| Molecular Formula | C11H11ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 259.2ºC |
|---|
Names
| Name | (2S)-1-(2-chloropyridine-4-carbonyl)pyrrolidine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.461g/cm3 |
|---|
| Boiling Point | 505ºC at 760mmHg |
|---|
| Molecular Formula | C11H11ClN2O3 |
|---|
| Molecular Weight | 254.67000 |
|---|
| Flash Point | 259.2ºC |
|---|
| Exact Mass | 254.04600 |
|---|
| PSA | 70.50000 |
|---|
| LogP | 1.36210 |
|---|
| Vapour Pressure | 5.07E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | KWIHFAPGRNEIHW-QMMMGPOBSA-N |
|---|
| SMILES | O=C(O)C1CCCN1C(=O)c1ccnc(Cl)c1 |
|---|
Synonyms
| N-(2-Chloropyridine-4-carbonyl)-L-proline |
| N-[(2-chloropyridin-4-yl)carbonyl]pyrrolidine-2-carboxylic acid |
| L-Proline,1-[(2-chloro-4-pyridinyl)carbonyl] |