Introduction：Basic information about CAS 191916-41-3|UNII-125FZ7WBJJ, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | UNII-125FZ7WBJJ |
|---|
| CAS Number | 191916-41-3 | Molecular Weight | 207.226 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 350.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H13NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.5±27.9 °C |
|---|
Names
| Name | (+)-Methylone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 350.1±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H13NO3 |
|---|
| Molecular Weight | 207.226 |
|---|
| Flash Point | 165.5±27.9 °C |
|---|
| Exact Mass | 207.089539 |
|---|
| PSA | 47.56000 |
|---|
| LogP | 0.81 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | VKEQBMCRQDSRET-ZETCQYMHSA-N |
|---|
| SMILES | CNC(C)C(=O)c1ccc2c(c1)OCO2 |
|---|
Synonyms
| (2S)-1-(1,3-benzodioxol-5-yl)-2-(methylamino)propan-1-one |
| 1-Propanone,1-(1,3-benzodioxol-5-yl)-2-(methylamino)-,(2S) |
| 3,4-methylenedioxymethcathinone |
| 1-Propanone,1-(1,3-benzodioxol-5-yl)-2-(methylamino)-,(S) |
| 1-Propanone, 1-(1,3-benzodioxol-5-yl)-2-(methylamino)- |
| UNII-125FZ7WBJJ |
| 1-(1,3-Benzodioxol-5-yl)-2-(methylamino)-1-propanone |
| bk-MDMA |
| 1-(1,3-Benzodioxol-5-yl)-2-(methylamino)propan-1-one |
| Methylone,(+) |
| (+)-bk-MDMA |
| UNII:L4I4B1R01F |
