Introduction：Basic information about CAS 68928-80-3|diphenyl ether, heptabromo derivative, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diphenyl ether, heptabromo derivative |
|---|
| CAS Number | 68928-80-3 | Molecular Weight | 722.48000 |
|---|
| Density | 2.643g/cm3 | Boiling Point | 495.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H3Br7O | Melting Point | 70-150ºC (decomposition) |
|---|
| MSDS | / | Flash Point | 207.2ºC |
|---|
Names
| Name | 1,2,3,4,5-pentabromo-6-(2,3-dibromophenoxy)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.643g/cm3 |
|---|
| Boiling Point | 495.3ºC at 760 mmHg |
|---|
| Melting Point | 70-150ºC (decomposition) |
|---|
| Molecular Formula | C12H3Br7O |
|---|
| Molecular Weight | 722.48000 |
|---|
| Flash Point | 207.2ºC |
|---|
| Exact Mass | 715.44700 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 8.81640 |
|---|
| Index of Refraction | 1.707 |
|---|
| InChIKey | NLBLNZDNOSSGPW-UHFFFAOYSA-N |
|---|
| SMILES | Brc1cccc(Oc2c(Br)c(Br)c(Br)c(Br)c2Br)c1Br |
|---|
Synonyms
| Benzene,1,1'-oxybis-,heptabromo deriv |
| EINECS 273-031-2 |
| Heptabromodiphenyl ether |
| Diphenyl ether,heptabromo derivative |
| Heptabromodiphenyl oxide |
