Introduction：Basic information about CAS 14510-37-3|Acetyltropylic chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetyltropylic chloride |
|---|
| CAS Number | 14510-37-3 | Molecular Weight | 226.65600 |
|---|
| Density | 1.228 | Boiling Point | 319ºC |
|---|
| Molecular Formula | C11H11ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 131ºC |
|---|
Names
| Name | (3-chloro-3-oxo-2-phenylpropyl) acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.228 |
|---|
| Boiling Point | 319ºC |
|---|
| Molecular Formula | C11H11ClO3 |
|---|
| Molecular Weight | 226.65600 |
|---|
| Flash Point | 131ºC |
|---|
| Exact Mass | 226.04000 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.09870 |
|---|
| InChIKey | PWWISFVVAKCNEF-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OCC(C(=O)Cl)c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2915390090 |
|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| acetyltropyl chloride |
| O-acetyltropoyl chloride |
| I01-3177 |
| 3-Acetoxy-2-phenyl-propionsaeure-chlorid |
| Acetyltropylic chloride |
| 3-acetoxy-2-phenyl-propionyl chloride |
