Introduction：Basic information about CAS 55940-73-3|oxydipropylene disalicylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | oxydipropylene disalicylate |
|---|
| CAS Number | 55940-73-3 | Molecular Weight | 374.38400 |
|---|
| Density | 1.264g/cm3 | Boiling Point | 453.9ºC at 760mmHg |
|---|
| Molecular Formula | C20H22O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.2ºC |
|---|
Names
| Name | 1-[2-(2-hydroxybenzoyl)oxypropoxy]propan-2-yl 2-hydroxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.264g/cm3 |
|---|
| Boiling Point | 453.9ºC at 760mmHg |
|---|
| Molecular Formula | C20H22O7 |
|---|
| Molecular Weight | 374.38400 |
|---|
| Flash Point | 152.2ºC |
|---|
| Exact Mass | 374.13700 |
|---|
| PSA | 102.29000 |
|---|
| LogP | 2.90520 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | HSUZMJLDSUYWEM-UHFFFAOYSA-N |
|---|
| SMILES | CC(COCC(C)OC(=O)c1ccccc1O)OC(=O)c1ccccc1O |
|---|
Synonyms
| Oxydipropylene disalicylate |
| EINECS 259-914-5 |
| Dipropyleneglycolsalicylate |
