Introduction：Basic information about CAS 59071-10-2|2-[ethyl[(pentadecafluoroheptyl)sulphonyl]amino]ethyl acrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[ethyl[(pentadecafluoroheptyl)sulphonyl]amino]ethyl acrylate |
|---|
| CAS Number | 59071-10-2 | Molecular Weight | 575.29000 |
|---|
| Density | 1.56g/cm3 | Boiling Point | 352ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12F15NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.7ºC |
|---|
Names
| Name | 2-[ethyl(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptylsulfonyl)amino]ethyl prop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.56g/cm3 |
|---|
| Boiling Point | 352ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12F15NO4S |
|---|
| Molecular Weight | 575.29000 |
|---|
| Flash Point | 166.7ºC |
|---|
| Exact Mass | 575.02500 |
|---|
| PSA | 72.06000 |
|---|
| LogP | 5.77970 |
|---|
| Index of Refraction | 1.368 |
|---|
| InChIKey | IIEYFHNUKYSWAV-UHFFFAOYSA-N |
|---|
| SMILES | C=CC(=O)OCCN(CC)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Synonyms
| 2-Propenoic acid,2-(ethyl(pentadecafluoroheptyl)sulfonyl)amino)ethyl ester |
| 2-(Ethyl((pentadecafluoroheptyl)sulphonyl)amino)ethyl acrylate |
| 2-{ethyl[(pentadecafluoroheptyl)sulfonyl]amino}ethyl acrylate |
| EINECS 261-590-5 |
