Introduction：Basic information about CAS 38379-99-6|2,2',3,5',6-PCB, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2',3,5',6-PCB |
|---|
| CAS Number | 38379-99-6 | Molecular Weight | 326.433 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 358.1±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H5Cl5 | Melting Point | 100°C |
|---|
| MSDS | / | Flash Point | 168.3±23.9 °C |
|---|
Names
| Name | 2,2',3,5',6-Pentachlorobiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 358.1±37.0 °C at 760 mmHg |
|---|
| Melting Point | 100°C |
|---|
| Molecular Formula | C12H5Cl5 |
|---|
| Molecular Weight | 326.433 |
|---|
| Flash Point | 168.3±23.9 °C |
|---|
| Exact Mass | 323.883392 |
|---|
| LogP | 6.28 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.620 |
|---|
| InChIKey | GXNNLIMMEXHBKV-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc(Cl)c(-c2c(Cl)ccc(Cl)c2Cl)c1 |
|---|
Synonyms
| 1,1'-Biphenyl, 2,2',3,5',6-pentachloro- |
| 2,3,6,2',5'-Pentachlorobiphenyl |
| 2,2',3,5',6-Pentachlorobiphenyl |
| 1,2,4-trichloro-3-(2,5-dichlorophenyl)benzene |
| 2,2',3,5',6-Pentachloro-1,1'-biphenyl |
| 2,2',3,5',6-PCB |
