Introduction:Basic information about CAS 21752-34-1|(S)-(-)-LACTAMIDE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-(-)-LACTAMIDE |
|---|
| CAS Number | 21752-34-1 | Molecular Weight | 221.25200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H15NO3 | Melting Point | 99-102 °C |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-oxo-4-[[(1S)-1-phenylethyl]amino]butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 99-102 °C |
|---|
| Molecular Formula | C12H15NO3 |
|---|
| Molecular Weight | 221.25200 |
|---|
| Exact Mass | 221.10500 |
|---|
| PSA | 69.89000 |
|---|
| LogP | 2.56890 |
|---|
| Vapour Pressure | 1.23E-09mmHg at 25°C |
|---|
| InChIKey | WUEKFTPKHWMMIP-VIFPVBQESA-N |
|---|
| SMILES | CC(NC(=O)CCC(=O)O)c1ccccc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (S)-(-)-N-(1-Phenylethyl)succinamic acid |
| MFCD00077433 |
| EINECS 244-569-5 |
| (S)-4-oxo-4-[(1-phenylethyl)amino]butyric acid |
| N-((S)-1-Phenyl-aethyl)-succinamidsaeure |
| 4-oxo-4-{[(1s)-1-phenylethyl]amino}butanoic acid |
| N-<(S)-1-Phenyl-ethyl>-bernsteinsaeuremonoamid |
| N-((S)-1-phenylethyl)succinamic acid |