Introduction：Basic information about CAS 405264-04-2|2-fluoro-6-(trifluoromethyl)benzene-1-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-fluoro-6-(trifluoromethyl)benzene-1-sulfonyl chloride |
|---|
| CAS Number | 405264-04-2 | Molecular Weight | 262.609 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 250.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3ClF4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 105.4±27.3 °C |
|---|
Names
| Name | 2-fluoro-6-(trifluoromethyl)benzene-1-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 250.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H3ClF4O2S |
|---|
| Molecular Weight | 262.609 |
|---|
| Flash Point | 105.4±27.3 °C |
|---|
| Exact Mass | 261.947845 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 2.61 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.468 |
|---|
| InChIKey | VVCAQQGQZZLRJK-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1c(F)cccc1C(F)(F)F |
|---|
Synonyms
| Benzenesulfonyl chloride, 2-fluoro-6-(trifluoromethyl)- |
| 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride |
| penoxsulam intermediate |
| 2-fluoro-6-trifluoromethylbenzenesulfonyl chloride |
