CAS 21286-54-4|10-camphorsulfonyl chloride
Introduction：Basic information about CAS 21286-54-4|10-camphorsulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 10-camphorsulfonyl chloride | ||
|---|---|---|---|
| CAS Number | 21286-54-4 | Molecular Weight | 250.742 |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 349.4±15.0 °C at 760 mmHg |
| Molecular Formula | C10H15ClO3S | Melting Point | 67-68 °C |
| MSDS | ChineseUSA | Flash Point | 165.1±20.4 °C |
| Symbol | GHS05 | Signal Word | Danger |
Names
| Name | D(+)-10-Camphorsulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.4±15.0 °C at 760 mmHg |
| Melting Point | 67-68 °C |
| Molecular Formula | C10H15ClO3S |
| Molecular Weight | 250.742 |
| Flash Point | 165.1±20.4 °C |
| Exact Mass | 250.043045 |
| PSA | 59.59000 |
| LogP | 1.55 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | BGABKEVTHIJBIW-GMSGAONNSA-N |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)Cl)C(=O)C2 |
| Storage condition | 2~8°C |
Safety Information
| Symbol | GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2914700090 |
Customs
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
Articles3
More Articles| Orally active, nonpeptide oxytocin antagonists. J. Med. Chem. 35 , 3919, (1992) The first nonpeptide antagonists of the neurohypophyseal hormone, oxytocin (OT) are described. Derivatives of the spiroindenepiperidine ring system, these compounds include L-366,509, an orally bioava... | |
| [The HPLC analysis of chiral beta-receptor blockers]. Pharmazie 48(11) , 829-33, (1993) Investigations on direct separation by RP-HPLC of selected enantiomeric beta-adrenergic active agents are described. R- and S-1-phenylethylisocyanate (PEIC) as well as (1S)-(+)-campher-10-sulfonylchlo... | |
Synthesis , 947, (1992) |
Synonyms
| Bicyclo[2.2.1]heptane-1-methanesulfonyl chloride, 7,7-dimethyl-2-oxo-, (1S,4R)- |
| camphor-10-sulfonyl chloride |
| D-(+)-10-Camphorsulfonyl chloride |
| MFCD00064156 |
| (1S)-(+)-10-Camphorsulfonyl Chloride |
| camphor-10-sulfonic acid chloride |
| camphorsulfonyl chloride |
| ((1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonyl chloride |
| Dextro-10-camphorsulfonyl chloride |
| D(+)-10-Camphorsulfonyl Chloride |
| (1S)-Camphor-10-sulfonic acid chloride |
| (+)-Camphor-10-sulfonyl chloride |
| [(1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonyl chloride |
| EINECS 244-314-8 |
| 10-camphorsulfonyl chloride |
| Bicyclo[2.2.1]heptane-1-methanesulfonyl chloride, 7,7-dimethyl-2-oxo- |
| D-CAMPHOR-10-SULFONYL CHLORIDE |
| (7,7-Dimethyl-2-oxobicyclo[2.2.1]hept-1-yl)methansulfonylchlorid |
| (7,7-Dimethyl-2-oxobicyclo[2.2.1]hept-1-yl)-methanesulfonyl chloride |
| (+)-10-Camphorsulfonyl Chloride |
| (7,7-Dimethyl-2-oxobicyclo[2.2.1]hept-1-yl)methanesulfonyl chloride |
