Introduction：Basic information about CAS 807631-09-0|BK-2C-B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | BK-2C-B |
|---|
| CAS Number | 807631-09-0 | Molecular Weight | 274.111 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 383.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H12BrNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.9±27.9 °C |
|---|
Names
| Name | 2-amino-1-(4-bromo-2,5-dimethoxyphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 383.8±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H12BrNO3 |
|---|
| Molecular Weight | 274.111 |
|---|
| Flash Point | 185.9±27.9 °C |
|---|
| Exact Mass | 273.000061 |
|---|
| PSA | 61.55000 |
|---|
| LogP | 1.94 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | HFYJGAIOBIDRPX-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)CN)c(OC)cc1Br |
|---|
Synonyms
| 2-Amino-1-(4-bromo-2,5-dimethoxyphenyl)ethanone |
| bk-2C-B |
| Ethanone, 2-amino-1-(4-bromo-2,5-dimethoxyphenyl)- |
| Beta-keto 2C-B |
| βk-2C-B |
| β-keto 2C-B |
| 2-amino-1-(4-bromo-2,5-dimethoxyphenyl)ethan-1-one |
| 2-amino-4'-bromo-2',5'-dimethoxyacetophenone |
