Introduction：Basic information about CAS 194033-87-9|Tris(trimethylsilyl) antimonite, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tris(trimethylsilyl) antimonite |
|---|
| CAS Number | 194033-87-9 | Molecular Weight | 389.325 |
|---|
| Density | 1.1448 g/cm3 | Boiling Point | 80ºC/3mmHg |
|---|
| Molecular Formula | C9H27O3SbSi3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | antimony trimethylsiloxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1448 g/cm3 |
|---|
| Boiling Point | 80ºC/3mmHg |
|---|
| Molecular Formula | C9H27O3SbSi3 |
|---|
| Molecular Weight | 389.325 |
|---|
| Exact Mass | 388.030609 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 3.90660 |
|---|
| Index of Refraction | 1.4374 |
|---|
| InChIKey | COSQIFOPOPWGCU-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)O[Sb](O[Si](C)(C)C)O[Si](C)(C)C |
|---|
Synonyms
| 3,5-Dioxa-4-stiba-2,6-disilaheptane, 2,2,6,6-tetramethyl-4-[(trimethylsilyl)oxy]- |
| tris(trimethylsiloxy)antimony |
| Tris(trimethylsilyl) antimonite |
