Introduction:Basic information about CAS 217487-47-3|4-(4-fluorophenyl)-3-[2-(4-hydroxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-fluorophenyl)-3-[2-(4-hydroxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|
| CAS Number | 217487-47-3 | Molecular Weight | 315.36500 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 475.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H14FN3OS | Melting Point | 204ºC |
|---|
| MSDS | / | Flash Point | 241.6ºC |
|---|
Names
| Name | 4-(4-fluorophenyl)-3-[2-(4-hydroxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 475.9ºC at 760mmHg |
|---|
| Melting Point | 204ºC |
|---|
| Molecular Formula | C16H14FN3OS |
|---|
| Molecular Weight | 315.36500 |
|---|
| Flash Point | 241.6ºC |
|---|
| Exact Mass | 315.08400 |
|---|
| PSA | 89.74000 |
|---|
| LogP | 3.18590 |
|---|
| Vapour Pressure | 1.11E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.664 |
|---|
| InChIKey | CAQNCYJKSKYPSA-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(CCc2n[nH]c(=S)n2-c2ccc(F)cc2)cc1 |
|---|
Synonyms
| HMS542F16 |
| 4-{2-[4-(4-fluorophenyl)-5-mercapto-4H-1,2,4-triazol-3-yl]ethyl}phenol |