Introduction：Basic information about CAS 67990-76-5|1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4-octafluoro-4-iodobutoxy)ethanesulfonyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4-octafluoro-4-iodobutoxy)ethanesulfonyl fluoride |
|---|
| CAS Number | 67990-76-5 | Molecular Weight | 526.01100 |
|---|
| Density | 2.148g/cm3 | Boiling Point | 200.128ºC at 760 mmHg |
|---|
| Molecular Formula | C6F13IO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 74.835ºC |
|---|
Names
| Name | 1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4-octafluoro-4-iodobutoxy)ethanesulfonyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.148g/cm3 |
|---|
| Boiling Point | 200.128ºC at 760 mmHg |
|---|
| Molecular Formula | C6F13IO3S |
|---|
| Molecular Weight | 526.01100 |
|---|
| Flash Point | 74.835ºC |
|---|
| Exact Mass | 525.84100 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 5.45990 |
|---|
| Index of Refraction | 1.366 |
|---|
| InChIKey | LEWYCBRUDUVOLG-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
|---|
Synonyms
| 7-Iodoperfluoro-3-oxaheptanesulphonyl fluoride |
| 7-Iodoperfluoro-3-oxaheptanesulfonyl fluoride |
| 7-iodo-3-oxadodecafluoroheptanesulfonyl fluoride |
| PC6876 |
| 2-(4-Iodo-1,1,2,2,3,3,4,4-octafluorobutoxy)-1,1,2,2-tetrafluoroethanesulphonyl fluoride |
