Introduction：Basic information about CAS 30501-29-2|tetrachlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene, mixed isom, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetrachlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene, mixed isomers |
|---|
| CAS Number | 30501-29-2 | Molecular Weight | 346.07800 |
|---|
| Density | 1.42 g/cm3 | Boiling Point | 386.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12Cl4 | Melting Point | 130-140ºC |
|---|
| MSDS | / | Flash Point | 180.5ºC |
|---|
Names
| Name | tetrachlorotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene, mixed isomers |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.42 g/cm3 |
|---|
| Boiling Point | 386.3ºC at 760 mmHg |
|---|
| Melting Point | 130-140ºC |
|---|
| Molecular Formula | C16H12Cl4 |
|---|
| Molecular Weight | 346.07800 |
|---|
| Flash Point | 180.5ºC |
|---|
| Exact Mass | 343.96900 |
|---|
| LogP | 6.18400 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | QYFSCKPZVYAASR-UHFFFAOYSA-N |
|---|
| SMILES | Clc1c2ccc(c1Cl)CCc1ccc(c(Cl)c1Cl)CC2 |
|---|
Synonyms
| Parylene D |
| Tetrachloro[2.2]paracyclophane |
| Tetrachlorotricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene |
