Introduction:Basic information about CAS 1271-33-6|Bis(cyclopentadienyl)tungsten(IV) dihydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(cyclopentadienyl)tungsten(IV) dihydride |
|---|
| CAS Number | 1271-33-6 | Molecular Weight | 314.02600 |
|---|
| Density | / | Boiling Point | 41.5ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10W | Melting Point | 115ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | >230 |
|---|
| Symbol | GHS02, GHS05 | Signal Word | Danger |
|---|
Names
| Name | bis(cyclopentadienyl)tungsten dihydride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 41.5ºC at 760 mmHg |
|---|
| Melting Point | 115ºC(lit.) |
|---|
| Molecular Formula | C10H10W |
|---|
| Molecular Weight | 314.02600 |
|---|
| Flash Point | >230 |
|---|
| Exact Mass | 314.02900 |
|---|
| LogP | 2.04300 |
|---|
| Vapour Pressure | 418mmHg at 25°C |
|---|
| InChIKey | JOWMDCGSJNVRNE-UHFFFAOYSA-N |
|---|
| SMILES | [WH2].c1cc[cH-]c1.c1cc[cH-]c1 |
|---|
Safety Information
| Symbol | GHS02, GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H261-H314 |
|---|
| Supplemental HS | Reacts violently with water. |
|---|
| Precautionary Statements | P231 + P232-P280-P305 + P351 + P338-P310-P422 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | R14 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | UN 3131 4 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 4.3 |
|---|
Synonyms
| BIS(CYCLOPENTADIENYL)TUNGSTEN(IV) DIHYDRIDE |
| Tungstanocene dihydride |
| Bis(cyclopentadienyl)dihydrotungsten |
| Bis(cyclopentadienyl)tungsten dihydride |
| MFCD04126433 |
| Tungsten,bis(eta5-2,4-cyclopentadien-1-yl)dihydro |
| EINECS 253-479-5 |