Introduction：Basic information about CAS 269396-73-8|Fmoc-(R)-3-Amino-4-(4-iodophenyl)-butyric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-(R)-3-Amino-4-(4-iodophenyl)-butyric acid |
|---|
| CAS Number | 269396-73-8 | Molecular Weight | 527.35100 |
|---|
| Density | 1.541g/cm3 | Boiling Point | 671.3ºC at 760mmHg |
|---|
| Molecular Formula | C25H22INO4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 359.8ºC |
|---|
Names
| Name | Fmoc-(R)-3-amino-4-(4-iodophenyl)-butyric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.541g/cm3 |
|---|
| Boiling Point | 671.3ºC at 760mmHg |
|---|
| Molecular Formula | C25H22INO4 |
|---|
| Molecular Weight | 527.35100 |
|---|
| Flash Point | 359.8ºC |
|---|
| Exact Mass | 527.05900 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.60660 |
|---|
| Vapour Pressure | 6.19E-19mmHg at 25°C |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | HTZYQICRFPOZOG-GOSISDBHSA-N |
|---|
| SMILES | O=C(O)CC(Cc1ccc(I)cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
|---|
Synonyms
| fmoc-(r)-3-amino-4-(4-iodo-phenyl)-butyric acid |
| MFCD01860964 |
