Introduction:Basic information about CAS 59408-74-1|Boc-Hse(Bzl)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-Hse(Bzl)-OH |
|---|
| CAS Number | 59408-74-1 | Molecular Weight | 309.358 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 480.5±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H23NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 244.4±28.7 °C |
|---|
Names
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxybutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 480.5±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H23NO5 |
|---|
| Molecular Weight | 309.358 |
|---|
| Flash Point | 244.4±28.7 °C |
|---|
| Exact Mass | 309.157623 |
|---|
| PSA | 84.86000 |
|---|
| LogP | 3.37 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.520 |
|---|
| InChIKey | RFDXPGUBDAKLDM-ZDUSSCGKSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CCOCc1ccccc1)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(tert-butoxycarbonyl)-O-benzyl-L-homoserine |
| Boc-Hoser(Bzl)-OH |
| Boc-L-Hse(Bzl)-OH |
| N-Boc-4-O-benzyl-L-homoserine |
| O-Benzyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}homoserine |
| AmbotzBAA1294 |
| L-homoserine, N-[(1,1-dimethylethoxy)carbonyl]-O-(phenylmethyl)- |
| Boc-Hse(Bn)-OH |
| (S)-2-((tert-butoxy)carbonylamino)-4-(phenylmethoxy)butyric acid |
| Boc-HSE(OBzl)-OH |
| Boc-O-benzyl-L-homoserine |
| BOC-SER(TBU)-OH |
| Homoserine, N-[(1,1-dimethylethoxy)carbonyl]-O-(phenylmethyl)- |
| O-Benzyl-N-(tert-butoxycarbonyl)-L-homoserine |
| 4-benzyloxy-(2S)-tert-butoxycarbonylaminobutanoic acid |
| BOC-O-BENZYL-L-HOMOSERINE |
| Boc-β-Homo-Ser(Bzl)-OH |
| Boc-HomoSer(Bzl)-OH |