Introduction：Basic information about CAS 127-27-5|Pimaric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pimaric acid |
|---|
| CAS Number | 127-27-5 | Molecular Weight | 302.451 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 413.2±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H30O2 | Melting Point | 217-219° |
|---|
| MSDS | / | Flash Point | 198.7±23.4 °C |
|---|
Names
| Name | pimaric acid |
|---|
| Synonym | More Synonyms |
|---|
Pimaric acid BiologicalActivity
| Description | Pimaric acid is a resin acid that has been found in A. cordata and various pines. Pimaric acid reduces mRNA expression, protein levels, and promoter activity of matrix metalloproteinase-9 (MMP-9) in TNF-α-stimulated human aortic smooth muscle cells (HASMCs). |
|---|
| Related Catalog | Signaling Pathways >>Others >>Others |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 413.2±45.0 °C at 760 mmHg |
|---|
| Melting Point | 217-219° |
|---|
| Molecular Formula | C20H30O2 |
|---|
| Molecular Weight | 302.451 |
|---|
| Flash Point | 198.7±23.4 °C |
|---|
| Exact Mass | 302.224579 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 6.60 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.538 |
|---|
| InChIKey | MHVJRKBZMUDEEV-APQLOABGSA-N |
|---|
| SMILES | C=CC1(C)C=C2CCC3C(C)(C(=O)O)CCCC3(C)C2CC1 |
|---|
Safety Information
Synonyms
| Pimara-8(14),15-dien-18-oic acid |
| 1-phenanthrenecarboxylicacid,7-ethenyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahyd |
| Pimarsaeure |
| 1-Phenanthrenecarboxylic acid, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,4a,7-trimethyl-, (1R,4aR,4bS,7S,10aR)- |
| d-Pimaric acid |
| sandaracopimaric acid |
| 13a-Methyl-13-vinylpodocarp-8(14)-ene-15-oic Acid |
| Pimaric acid |
| Dextropimaric acid |
| α-Pimaric acid |
| (+)-Pimaric acid |
