Introduction：Basic information about CAS 87720-55-6|Fmoc-4,5-Dehydro-L-Leucine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-4,5-Dehydro-L-Leucine |
|---|
| CAS Number | 87720-55-6 | Molecular Weight | 351.396 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 569.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H21NO4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 298.4±28.7 °C |
|---|
Names
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 569.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H21NO4 |
|---|
| Molecular Weight | 351.396 |
|---|
| Flash Point | 298.4±28.7 °C |
|---|
| Exact Mass | 351.147064 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 5.03 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | YUPPKUMKKSBZRL-IBGZPJMESA-N |
|---|
| SMILES | C=C(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
Synonyms
| N-fluoren-9-ylmethyloxycarbonyl-4,5-dehydro-L-leucine |
| Fmoc-(S)-2-methallylglycine |
| 4-Pentenoicacid,2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4-methyl-,(S) |
| (2S)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpent-4-enoic acid |
| fmoc-4,5-dehydro-l-leucine |
| MFCD00237651 |
| L-Norvaline, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-methylene- |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-methylene-L-norvaline |
| Fmoc-4,5-Dehydro-L-Leucine |
