Introduction：Basic information about CAS 114306-00-2|3-acetyloxy-5-chloroindole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-acetyloxy-5-chloroindole |
|---|
| CAS Number | 114306-00-2 | Molecular Weight | 209.62900 |
|---|
| Density | 1.384g/cm3 | Boiling Point | 372.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H8ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 179.1ºC |
|---|
Names
| Name | 3-acetyloxy-5-chloroindole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.384g/cm3 |
|---|
| Boiling Point | 372.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H8ClNO2 |
|---|
| Molecular Weight | 209.62900 |
|---|
| Flash Point | 179.1ºC |
|---|
| Exact Mass | 209.02400 |
|---|
| PSA | 42.09000 |
|---|
| LogP | 2.74660 |
|---|
| Vapour Pressure | 9.5E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | IFSSBGDLKMSHCW-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1c[nH]c2ccc(Cl)cc12 |
|---|
Synonyms
| 3-acetoxy-5-chloroindole |
| acetic acid-(5-chloro-indol-3-yl ester) |
| Essigsaeure-(5-chlor-4-methyl-2-nitro-anilid) |
| Essigsaeure-(5-chlor-indol-3-ylester) |
| 5-chloro-4-methyl-2-nitroacetanilide |
| chloromethylnitrophenylacetamide |
| 6-Chlor-3-nitro-4-acetamino-toluol |
| acetic acid-(5-chloro-4-methyl-2-nitro-anilide) |
| N-Acetyl-5-chlor-2-nitro-p-toluidin |
