Introduction:Basic information about CAS 574758-47-7|1H-Indazole-7-sulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indazole-7-sulfonic acid |
|---|
| CAS Number | 574758-47-7 | Molecular Weight | 198.199 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H6N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1H-indazole-7-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Molecular Formula | C7H6N2O3S |
|---|
| Molecular Weight | 198.199 |
|---|
| Exact Mass | 198.009918 |
|---|
| PSA | 91.43000 |
|---|
| LogP | 0.07 |
|---|
| Index of Refraction | 1.717 |
|---|
| InChIKey | ZOKUJQYNWMSFJF-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1cccc2cn[nH]c12 |
|---|
Synonyms
| 7-(1H)Indazole sulfonic acid |
| 1H-Indazole-7-sulfonic acid |