Introduction：Basic information about CAS 80269-97-2|1-Butanone,4-chloro-1-(2,4-dimethoxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Butanone,4-chloro-1-(2,4-dimethoxyphenyl)- |
|---|
| CAS Number | 80269-97-2 | Molecular Weight | 242.69900 |
|---|
| Density | 1.137g/cm3 | Boiling Point | 381.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H15ClO3 | Melting Point | 58ºC |
|---|
| MSDS | / | Flash Point | 157.6ºC |
|---|
Names
| Name | 4-chloro-1-(2,4-dimethoxyphenyl)butan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.137g/cm3 |
|---|
| Boiling Point | 381.6ºC at 760mmHg |
|---|
| Melting Point | 58ºC |
|---|
| Molecular Formula | C12H15ClO3 |
|---|
| Molecular Weight | 242.69900 |
|---|
| Flash Point | 157.6ºC |
|---|
| Exact Mass | 242.07100 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 2.90550 |
|---|
| Index of Refraction | 1.509 |
|---|
| InChIKey | XWCCYSWTIUDHGA-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)CCCCl)c(OC)c1 |
|---|
Synonyms
| 4-Chlor-1-<2,4-dimethoxy-phenyl>-butan-1-on |
| 4-chloro-2',4'-dimethoxybutyrophenone |
| 4-Chlor-2',4'-dimethoxybutyrophenon |
