Introduction：Basic information about CAS 30377-52-7|ethyl perfluorononanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl perfluorononanoate |
|---|
| CAS Number | 30377-52-7 | Molecular Weight | 492.12900 |
|---|
| Density | 1.605 g/cm3 | Boiling Point | 84-85°C 15mm |
|---|
| Molecular Formula | C11H5F17O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 68.8ºC |
|---|
Names
| Name | ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.605 g/cm3 |
|---|
| Boiling Point | 84-85°C 15mm |
|---|
| Molecular Formula | C11H5F17O2 |
|---|
| Molecular Weight | 492.12900 |
|---|
| Flash Point | 68.8ºC |
|---|
| Exact Mass | 492.00200 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 5.55890 |
|---|
| Index of Refraction | 1.299 |
|---|
| InChIKey | DRLDSHOYANTUND-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | F |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2915900090 |
|---|
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| ethyl heptadecafluoro-n-nonanoate |
| perfluorononanoic acid ethyl ester |
| MFCD00039245 |
| ethyl perfluoropelargonate |
| ethyl Perfluorononanoate |
| Heptadecafluorononanoic Acid Ethyl Ester |
| Ethyl perfluorononan-1-oate |
| Ethyl Heptadecafluorononanoate |
| Ethyl-perfluoro-n-octyl-carboxylat |
| ethyl perfluorononanate |
| EINECS 250-159-7 |
