Introduction：Basic information about CAS 352018-98-5|4-CYCLOPROPYL-5-(4-METHYL-1,2,3-THIADIAZOL-5-YL)-4H-1,2,4-TRIAZOLE-3-THIOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-CYCLOPROPYL-5-(4-METHYL-1,2,3-THIADIAZOL-5-YL)-4H-1,2,4-TRIAZOLE-3-THIOL |
|---|
| CAS Number | 352018-98-5 | Molecular Weight | 239.32100 |
|---|
| Density | 1.87g/cm3 | Boiling Point | 462.1ºC at 760 mmHg |
|---|
| Molecular Formula | C8H9N5S2 | Melting Point | 212ºC |
|---|
| MSDS | / | Flash Point | 233.3ºC |
|---|
Names
| Name | 4-cyclopropyl-5-(4-methyl-2H-thiadiazol-5-ylidene)-1,2,4-triazole-3-thione |
|---|
Chemical & Physical Properties
| Density | 1.87g/cm3 |
|---|
| Boiling Point | 462.1ºC at 760 mmHg |
|---|
| Melting Point | 212ºC |
|---|
| Molecular Formula | C8H9N5S2 |
|---|
| Molecular Weight | 239.32100 |
|---|
| Flash Point | 233.3ºC |
|---|
| Exact Mass | 239.03000 |
|---|
| PSA | 123.53000 |
|---|
| LogP | 1.72860 |
|---|
| Index of Refraction | 1.976 |
|---|
| InChIKey | XLMRIINQVDCVHI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nnsc1-c1n[nH]c(=S)n1C1CC1 |
|---|
Safety Information
