Introduction:Basic information about CAS 423768-50-7|ethyl 5-(5-bromothiophen-2-yl)-1,2-oxazole-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 5-(5-bromothiophen-2-yl)-1,2-oxazole-3-carboxylate |
|---|
| CAS Number | 423768-50-7 | Molecular Weight | 302.14400 |
|---|
| Density | 1.583g/cm3 | Boiling Point | 406.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H8BrNO3S | Melting Point | 51ºC |
|---|
| MSDS | / | Flash Point | 199.7ºC |
|---|
Names
| Name | ethyl 5-(5-bromothiophen-2-yl)-1,2-oxazole-3-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.583g/cm3 |
|---|
| Boiling Point | 406.7ºC at 760 mmHg |
|---|
| Melting Point | 51ºC |
|---|
| Molecular Formula | C10H8BrNO3S |
|---|
| Molecular Weight | 302.14400 |
|---|
| Flash Point | 199.7ºC |
|---|
| Exact Mass | 300.94100 |
|---|
| PSA | 80.57000 |
|---|
| LogP | 3.34230 |
|---|
| Index of Refraction | 1.582 |
|---|
| InChIKey | OIZZMDOBYXRSNQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(-c2ccc(Br)s2)on1 |
|---|
Safety Information