Introduction：Basic information about CAS 150975-95-4|5-methylsulfonaminoindole-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-methylsulfonaminoindole-2-carboxylic acid |
|---|
| CAS Number | 150975-95-4 | Molecular Weight | 254.26200 |
|---|
| Density | 1.641g/cm3 | Boiling Point | 564.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H10N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 295.2ºC |
|---|
Names
| Name | 5-(methanesulfonamido)-1H-indole-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.641g/cm3 |
|---|
| Boiling Point | 564.6ºC at 760mmHg |
|---|
| Molecular Formula | C10H10N2O4S |
|---|
| Molecular Weight | 254.26200 |
|---|
| Flash Point | 295.2ºC |
|---|
| Exact Mass | 254.03600 |
|---|
| PSA | 107.64000 |
|---|
| LogP | 2.39140 |
|---|
| Vapour Pressure | 1.39E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.726 |
|---|
| InChIKey | AHXMYKDPQPQFMW-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)Nc1ccc2[nH]c(C(=O)O)cc2c1 |
|---|
Synonyms
| MFCD00236371 |
| 5-Methylsulfonaminoindole-2-carboxylic acid |
| 5-methanesulfonamidoindole-2-carboxylic acid |
