Introduction:Basic information about CAS 90348-28-0|4,5-DINITROPHTHALIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5-DINITROPHTHALIC ACID |
|---|
| CAS Number | 90348-28-0 | Molecular Weight | 256.12600 |
|---|
| Density | 1.853g/cm3 | Boiling Point | 551ºC at 760 mmHg |
|---|
| Molecular Formula | C8H4N2O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.3ºC |
|---|
Names
| Name | 4,5-dinitrophthalic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.853g/cm3 |
|---|
| Boiling Point | 551ºC at 760 mmHg |
|---|
| Molecular Formula | C8H4N2O8 |
|---|
| Molecular Weight | 256.12600 |
|---|
| Flash Point | 243.3ºC |
|---|
| Exact Mass | 255.99700 |
|---|
| PSA | 166.24000 |
|---|
| LogP | 1.94580 |
|---|
| Index of Refraction | 1.696 |
|---|
| InChIKey | MJJVUJBKOFXFJW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc([N+](=O)[O-])c([N+](=O)[O-])cc1C(=O)O |
|---|
Synonyms
| 4,5-dinitro-phthalic acid |
| 1,2-Benzenedicarboxylicacid,4,5-dinitro |
| 4,5-Dinitro-phthalsaeure |