Introduction：Basic information about CAS 433289-59-9|N-(methoxymethyl)-1-(4-methoxyphenyl)-N-(trimethylsilylmethyl)methanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(methoxymethyl)-1-(4-methoxyphenyl)-N-(trimethylsilylmethyl)methanamine |
|---|
| CAS Number | 433289-59-9 | Molecular Weight | 267.43900 |
|---|
| Density | 0.961g/cm3 | Boiling Point | 288.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H25NO2Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 128.3ºC |
|---|
Names
| Name | N-(methoxymethyl)-1-(4-methoxyphenyl)-N-(trimethylsilylmethyl)methanamine |
|---|
Chemical & Physical Properties
| Density | 0.961g/cm3 |
|---|
| Boiling Point | 288.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H25NO2Si |
|---|
| Molecular Weight | 267.43900 |
|---|
| Flash Point | 128.3ºC |
|---|
| Exact Mass | 267.16500 |
|---|
| PSA | 21.70000 |
|---|
| LogP | 3.39680 |
|---|
| Index of Refraction | 1.485 |
|---|
| InChIKey | MYMIAGKKDMXTGP-UHFFFAOYSA-N |
|---|
| SMILES | COCN(Cc1ccc(OC)cc1)C[Si](C)(C)C |
|---|
