Introduction：Basic information about CAS 55845-78-8|Xenipentone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Xenipentone |
|---|
| CAS Number | 55845-78-8 | Molecular Weight | 236.30800 |
|---|
| Density | 1.031g/cm3 | Boiling Point | 394.1ºC at 760mmHg |
|---|
| Molecular Formula | C17H16O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.9ºC |
|---|
Names
| Name | (E)-4-(4-phenylphenyl)pent-3-en-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.031g/cm3 |
|---|
| Boiling Point | 394.1ºC at 760mmHg |
|---|
| Molecular Formula | C17H16O |
|---|
| Molecular Weight | 236.30800 |
|---|
| Flash Point | 150.9ºC |
|---|
| Exact Mass | 236.12000 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.34590 |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | AAOLGDRTKZMLIG-OUKQBFOZSA-N |
|---|
| SMILES | CC(=O)C=C(C)c1ccc(-c2ccccc2)cc1 |
|---|
Synonyms
| Xenipentonum |
| Xenipentone |
| UNII-GP581VM303 |
