Introduction：Basic information about CAS 122111-01-7|2-Deoxy-2,2-difluoro-D-erythro-pentafuranous-1-ulose-3,5-dibenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Deoxy-2,2-difluoro-D-erythro-pentafuranous-1-ulose-3,5-dibenzoate |
|---|
| CAS Number | 122111-01-7 | Molecular Weight | 376.308 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 437.2±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H14F2O6 | Melting Point | 117-119ºC(lit.) |
|---|
| MSDS | / | Flash Point | 210.5±23.6 °C |
|---|
Names
| Name | 2-Deoxy-2,2-difluoro-D-erythro-pentonic Acid γ-Lactone 3,5-Dibenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 437.2±45.0 °C at 760 mmHg |
|---|
| Melting Point | 117-119ºC(lit.) |
|---|
| Molecular Formula | C19H14F2O6 |
|---|
| Molecular Weight | 376.308 |
|---|
| Flash Point | 210.5±23.6 °C |
|---|
| Exact Mass | 376.075836 |
|---|
| PSA | 78.90000 |
|---|
| LogP | 4.08 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | SHHNEUNVMZNOID-LSDHHAIUSA-N |
|---|
| SMILES | O=C(OCC1OC(=O)C(F)(F)C1OC(=O)c1ccccc1)c1ccccc1 |
|---|
| Storage condition | -20°C Freezer |
|---|
Safety Information
| Hazard Codes | F+ |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| ((2R,3R)-3-(Benzoyloxy)-4,4-difluoro-5-oxotetrahydrofuran-2-yl)methyl benzoate |
| 2-Deoxyl-2,2-difluoro-D-erythro-pentofuranos-1-ulose-3,5-dibenzoate |
| 2-Deoxy-2,2-Difluoro-d-Erythro-Pentofuranos-1-Ulose-3,5-Dibenzoate |
| (2R,3R)-4,4-Difluor-5-oxo-2-{[(phenylcarbonyl)oxy]methyl}tetrahydrofuran-3-ylbenzolcarboxylat (non-preferred name) |
| [(2R,3R)-3-(Benzoyloxy)-4,4-difluoro-5-oxotetrahydro-2-furanyl]methyl benzoate (non-preferred name) |
| (2R,3R)-4,4-Difluoro-5-oxo-2-{[(phenylcarbonyl)oxy]methyl}tetrahydrofuran-3-yl benzoate (non-preferred name) |
| [(2R,3R)-3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl]methyl benzoate |
| [(2R,3R)-3-(Benzoyloxy)-4,4-difluoro-5-oxotetrahydrofuran-2-yl]methyl benzoate (non-preferred name) |
| [(2R,3R)-3-(Benzoyloxy)-4,4-difluoro-5-oxotetrahydro-2-furanyl]methyl benzoate |
| [(2R,3R)-3-(benzoyloxy)-4,4-difluoro-5-oxotetrahydrofuran-2-yl]methyl benzoate |
| T5OVTJ CF CF DOVR& E1OVR &&D-Erythro Form |
| D-erythro-Pentonicacid, 2-deoxy-2,2-difluoro--lactone,3,5-dibenzoate |
| 2-Deoxy-2,2-difluoro-D-erythro-pentonic acid g-lactone 3,5-dibenzoate |
| 2-Deoxy-2,2-difluoro-D-erythro-pentonic acid γ-Lactone 3,5-dibenzoate |
| MFCD00209570 |
