Introduction:Basic information about CAS 596845-30-6|2-Bromo-6-fluoro-4-(trifluoromethyl)quinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromo-6-fluoro-4-(trifluoromethyl)quinoline |
|---|
| CAS Number | 596845-30-6 | Molecular Weight | 294.04300 |
|---|
| Density | 1.722 | Boiling Point | 295ºC |
|---|
| Molecular Formula | C10H4BrF4N | Melting Point | 108-109ºC |
|---|
| MSDS | / | Flash Point | 132ºC |
|---|
Names
| Name | 2-Bromo-6-fluoro-4-(trifluoromethyl)quinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.722 |
|---|
| Boiling Point | 295ºC |
|---|
| Melting Point | 108-109ºC |
|---|
| Molecular Formula | C10H4BrF4N |
|---|
| Molecular Weight | 294.04300 |
|---|
| Flash Point | 132ºC |
|---|
| Exact Mass | 292.94600 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.15520 |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | YIJYXAAALOPGOS-UHFFFAOYSA-N |
|---|
| SMILES | Fc1ccc2nc(Br)cc(C(F)(F)F)c2c1 |
|---|
Synonyms