Introduction：Basic information about CAS 43115-40-8|2-Amino-4-(ethylsulfonyl)phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Amino-4-(ethylsulfonyl)phenol |
|---|
| CAS Number | 43115-40-8 | Molecular Weight | 201.243 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 436.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H11NO3S | Melting Point | 128-131ºC(lit.) |
|---|
| MSDS | / | Flash Point | 217.7±28.7 °C |
|---|
Names
| Name | 2-amino-4-ethylsulfonylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 436.4±45.0 °C at 760 mmHg |
|---|
| Melting Point | 128-131ºC(lit.) |
|---|
| Molecular Formula | C8H11NO3S |
|---|
| Molecular Weight | 201.243 |
|---|
| Flash Point | 217.7±28.7 °C |
|---|
| Exact Mass | 201.045959 |
|---|
| PSA | 88.77000 |
|---|
| LogP | -0.52 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | UPJVUFCLBYQKFH-UHFFFAOYSA-N |
|---|
| SMILES | CCS(=O)(=O)c1ccc(O)c(N)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922299090 |
|---|
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 1-amino-5-ethylsulfonyl-2-hydroxybenzene |
| 4-ethylsulfonyl-2-aminophenol |
| 4-ethylsulphonyl-2-aminophenol |
| 2-Amino-4-(ethylsulfonyl)phenol |
| 2-amino-4-ethanesulfonylphenol |
| phenol,2-amino-4-(ethylsulfonyl) |
| Phenol, 2-amino-4-(ethylsulfonyl)- |
| MFCD00035895 |
| EINECS 256-100-1 |
