Introduction：Basic information about CAS 14606-42-9|triphenylsilanethiol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | triphenylsilanethiol |
|---|
| CAS Number | 14606-42-9 | Molecular Weight | 292.47000 |
|---|
| Density | 1.12g/cm3 | Boiling Point | 385.7ºC at 760 mmHg |
|---|
| Molecular Formula | C18H16SSi | Melting Point | 101-104ºC(lit.) |
|---|
| MSDS | / | Flash Point | 187.1ºC |
|---|
Names
| Name | triphenyl(sulfanyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.12g/cm3 |
|---|
| Boiling Point | 385.7ºC at 760 mmHg |
|---|
| Melting Point | 101-104ºC(lit.) |
|---|
| Molecular Formula | C18H16SSi |
|---|
| Molecular Weight | 292.47000 |
|---|
| Flash Point | 187.1ºC |
|---|
| Exact Mass | 292.07400 |
|---|
| PSA | 38.80000 |
|---|
| LogP | 2.58330 |
|---|
| Vapour Pressure | 8.28E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | MQDRKELSDPESDZ-UHFFFAOYSA-N |
|---|
| SMILES | S[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| triphenylsilylthiol |
| MFCD00192551 |
| triphenyl-silanethiol |
| Silanethiol,1,1,1-triphenyl |
| Mercaptotriphenylsilane |
