Introduction：Basic information about CAS 207857-35-0|fmoc-arg(z)2-oh, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | fmoc-arg(z)2-oh |
|---|
| CAS Number | 207857-35-0 | Molecular Weight | 664.704 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C37H36N4O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C37H36N4O8 |
|---|
| Molecular Weight | 664.704 |
|---|
| Exact Mass | 664.253296 |
|---|
| PSA | 164.65000 |
|---|
| LogP | 7.29 |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | SLWMVWWEOHTNTR-YTTGMZPUSA-N |
|---|
| SMILES | O=C(NC(=NCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)NC(=O)OCc1ccccc1)OCc1ccccc1 |
|---|
| Storage condition | -15°C |
|---|
Synonyms
| AmbotzFAA6240 |
| (9-Fluorenylmethoxycarbonyl)-Ngamma-bis-carbobenzoxy-L-arginine |
| N-(3,7-Dioxo-1,9-diphenyl-2,8-dioxa-4,6-diazanonan-5-ylidene)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-ornithine |
| L-Ornithine, N-[bis[[(phenylmethoxy)carbonyl]amino]methylene]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
