Introduction：Basic information about CAS 95127-15-4|3-Benzylidene-2-oxo-cyclopentanecarboxylic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Benzylidene-2-oxo-cyclopentanecarboxylic acid ethyl ester |
|---|
| CAS Number | 95127-15-4 | Molecular Weight | 244.28600 |
|---|
| Density | 1.179g/cm3 | Boiling Point | 384ºC at 760mmHg |
|---|
| Molecular Formula | C15H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 170.1ºC |
|---|
Names
| Name | 3-Benzylidene-2-oxo-cyclopentanecarboxylic acid ethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.179g/cm3 |
|---|
| Boiling Point | 384ºC at 760mmHg |
|---|
| Molecular Formula | C15H16O3 |
|---|
| Molecular Weight | 244.28600 |
|---|
| Flash Point | 170.1ºC |
|---|
| Exact Mass | 244.11000 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.61220 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | KHALZHFCWRDVCU-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1CCC(=Cc2ccccc2)C1=O |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| benzylidene-(4-benzylsulfanyl-2-phenyl-oxazol-5-yl)-amine |
| methyl 3-(hydroxy(phenyl)methyl)-2-oxocyclopentanecarboxylate |
| N-(4-BENZYLSULFANYL-2-PHENYL-1,3-OXAZOL-5-YL)-1-PHENYL-METHANIMINE |
| 3-Benzyliden-1-aethoxycarbonyl-cyclopentanon-(2) |
| 5-Benzylidenamino-4-benzylmercapto-2-phenyl-oxazol |
| 5-Benzyliden-cyclopentanon-carbonsaeure-(2)-aethylester |
