Introduction:Basic information about CAS 113994-38-0|2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-3,5-pyridinedicarboxyli, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-3,5-pyridinedicarboxylic acid 3-ethyl ester |
|---|
| CAS Number | 113994-38-0 | Molecular Weight | 392.83300 |
|---|
| Density | 1.298 | Boiling Point | / |
|---|
| Molecular Formula | C19H21ClN2O5 | Melting Point | 70-73ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-5-ethoxycarbonyl-2-methylpyridine-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.298 |
|---|
| Melting Point | 70-73ºC |
|---|
| Molecular Formula | C19H21ClN2O5 |
|---|
| Molecular Weight | 392.83300 |
|---|
| Exact Mass | 392.11400 |
|---|
| PSA | 111.74000 |
|---|
| LogP | 3.76090 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | YLAOOGNJINQWFK-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c(COCCN)nc(C)c(C(=O)O)c1-c1ccccc1Cl |
|---|
Synonyms
| UNII-8GL2721R3F |
| 2-((2-Aminoethoxy)methyl)-4-(2-chlorophenyl)-6-methyl-3,5-pyridinedicarboxylic acid,3-ethyl ester |
| 3,5-Pyridinedicarboxylicacid,2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-,3-ethyl ester |