Introduction：Basic information about CAS 192130-34-0|tert-Butyl 4-(2-aminoethyl)piperazine-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl 4-(2-aminoethyl)piperazine-1-carboxylate |
|---|
| CAS Number | 192130-34-0 | Molecular Weight | 229.319 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 319.4±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H23N3O2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 147.0±25.1 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-butyl 4-(2-aminoethyl)piperazine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 319.4±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H23N3O2 |
|---|
| Molecular Weight | 229.319 |
|---|
| Flash Point | 147.0±25.1 °C |
|---|
| Exact Mass | 229.179031 |
|---|
| PSA | 58.80000 |
|---|
| LogP | 0.27 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.495 |
|---|
| InChIKey | QSYTWBKZNNEKPN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(CCN)CC1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD02683049 |
| 4-(2-aminoethyl)piperazine-1-carboxylic acid tert-butyl ester |
| 1-Boc-4-(2-aminoethyl)piperazine |
| 4-(2-Amino-ethyl)-1-Boc-piperazine |
| 1-(2-aminoethyl)-4-Boc piperazine |
| tert-Butyl 4-(2-aminoethyl)piperazine-1-carboxylate |
| 4-(2-aminoethyl)piperazine,n1-boc protected |
| 4-(2-Amino-Ethyl)-Piperazine-1-Carboxylic Acid Tert-Butyl Ester |
| 1-(2-aminoethyl)-4-tert-butoxycarbonylpiperazine |
| 1-(2-aminoethyl)-4-(t-butoxycarbonyl)piperazine |
| 4-(2-Aminoethyl)-1-boc-piperazine |
| 1-tert-butyloxycarbonyl-4-(2-aminoethyl)piperazine |
| 4-N-(2-Aminoethyl)-1-N-Boc-piperazine |
| tert-butyl 4-(2-aminoethyl)-1-piperazinecarboxylate |
