Introduction：Basic information about CAS 158985-36-5|1-Boc-4-(4-methoxycarbonylphenyl)piperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Boc-4-(4-methoxycarbonylphenyl)piperazine |
|---|
| CAS Number | 158985-36-5 | Molecular Weight | 320.384 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 451.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H24N2O4 | Melting Point | 166-167ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 227.0±27.3 °C |
|---|
| Symbol |
GHS06 | Signal Word | Danger |
|---|
Names
| Name | tert-butyl 4-(4-methoxycarbonylphenyl)piperazine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 451.7±40.0 °C at 760 mmHg |
|---|
| Melting Point | 166-167ºC |
|---|
| Molecular Formula | C17H24N2O4 |
|---|
| Molecular Weight | 320.384 |
|---|
| Flash Point | 227.0±27.3 °C |
|---|
| Exact Mass | 320.173615 |
|---|
| PSA | 59.08000 |
|---|
| LogP | 2.23 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.536 |
|---|
| InChIKey | SMDBCJAJWDCJOP-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
|---|
Safety Information
| Symbol |
GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H300-H319 |
|---|
| Precautionary Statements | P264-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T: Toxic; |
|---|
| Risk Phrases | R25;R52/53 |
|---|
| Safety Phrases | 45 |
|---|
| RIDADR | UN 2811 |
|---|
| WGK Germany | 2 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| tert-butyl 4-(4-(methoxycarbonyl)phenyl)piperazine-1-carboxylate |
| 1-(tert-Butoxycarbonyl)-4-(4-hydroxymethylphenyl)piperazine |
| 2-Methyl-2-propanyl 4-[4-(methoxycarbonyl)phenyl]-1-piperazinecarboxylate |
| 4-[4-(methoxycarbonyl)phenyl]-1-piperazinecarboxylic acid 1,1-dimethylethyl ester |
| tert-Butyl 4-[4-(methoxycarbonyl)phenyl]piperazine-1-carboxylate |
| 1-(tert-butoxycarbonyl)-4-(4-methoxycarbonylphenyl)piperazine |
| TERT-BUTYL 4-[4-(HYDROXYMETHYL)PHENYL]TETRAHYDRO-1(2H)-PYRAZINECARBOXYLATE |
| 4-(4-methoxycarbonyl-phenyl)-piperazine-1-carboxylic acid tert-butyl ester |
| 4-[4-(Methoxycarbonyl)phenyl]-1-piperazinecarboxylic acid, 1,1-dimethylethyl ester |
| Methyl 4-(N-Boc-N'-piperazinyl)benzoate |
| 1-hydroxymethyl-4-(4-(1,1-dimethylethoxycarbonyl)piperazinyl)benzene |
| 4-(4-N-Boc-piperazinyl)benzylalcohol |
| 1-Piperazinecarboxylic acid, 4-[4-(methoxycarbonyl)phenyl]-, 1,1-dimethylethyl ester |
| tert-Butyl 4-(4-(hydroxymethyl)phenyl)piperazine-1-carboxylate |
