Introduction:Basic information about CAS 19499-61-7|N-methyl-N-(3-nitrobenzyl)amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-methyl-N-(3-nitrobenzyl)amine |
|---|
| CAS Number | 19499-61-7 | Molecular Weight | 166.177 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 274.3±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 119.7±20.4 °C |
|---|
Names
| Name | (3-Nitrobenzyl)methylamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 274.3±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H10N2O2 |
|---|
| Molecular Weight | 166.177 |
|---|
| Flash Point | 119.7±20.4 °C |
|---|
| Exact Mass | 166.074234 |
|---|
| PSA | 57.85000 |
|---|
| LogP | 1.25 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | NTPAPKLGADEFAM-UHFFFAOYSA-N |
|---|
| SMILES | CNCc1cccc([N+](=O)[O-])c1 |
|---|
| Storage condition | 2-8°C |
|---|
| Water Solubility | Slightly soluble in water. |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 23 26 6 36/37/39 |
|---|
| RIDADR | 2735.0 |
|---|
| HS Code | 2921499090 |
|---|
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| methyl[(3-nitrophenyl)methyl]amine |
| Benzenemethanamine, N-methyl-3-nitro- |
| Methyl-(3-nitro-benzyl)-amin |
| N-methyl-N-(3-nitrobenzyl)amine |
| N-methyl-N-[(3-nitrophenyl)methyl]amine |
| (3-Nitrobenzyl)methy |
| N-Methyl-1-(3-nitrophenyl)methanamine |
| 3-Nitro-N-methylbenzylamine |
| N-Methyl(3-nitrophenyl)methanamine |
| N-methyl-1-(3-nitrophenyl)methylamine |
| methyl-(3-nitro-benzyl)-amine |
| N-(3-nitrophenylmethyl)methylamine |